CAS 2940873-23-2 appears in our catalog under these names: O1-tert-butyl O2-methyl cis-5-aminopiperidine-1,2-dicarboxylate oxalic acid, 95%, O1-tert-butyl O2-methyl cis-5-aminopiperidine-1,2-dicarboxylate oxalic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g.
1-O-tert-butyl 2-O-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate;oxalic acid (CAS 2940873-23-2) is a chemical compound with the molecular formula C14H24N2O8 and a molecular weight of 348.35 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate;oxalic acid. InChIKey: PDYGMWSHFITKAM-OZZZDHQUSA-N.
| Molecular formula | C14H24N2O8 |
|---|---|
| Molecular weight | 348.35 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,5S)-5-aminopiperidine-1,2-dicarboxylate;oxalic acid |
| InChIKey | PDYGMWSHFITKAM-OZZZDHQUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](CC[C@H]1C(=O)OC)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)