Products 2725774-12-7

CAS 2725774-12-7 is the registry number for 1-(tert-Butyl) 2-methyl (2S,4R)-4-aminopiperidine-1,2-dicarboxylate oxalate, 97%. Offered by: AmBeed. Available pack sizes: 1g.

1-O-tert-butyl 2-O-methyl (2S,4R)-4-aminopiperidine-1,2-dicarboxylate;oxalic acid (CAS 2725774-12-7) is a chemical compound with the molecular formula C14H24N2O8 and a molecular weight of 348.35 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-aminopiperidine-1,2-dicarboxylate;oxalic acid. InChIKey: NTRQSPSLGSDKMN-RJUBDTSPSA-N.

Identity
Molecular formulaC14H24N2O8
Molecular weight348.35 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl (2S,4R)-4-aminopiperidine-1,2-dicarboxylate;oxalic acid
InChIKeyNTRQSPSLGSDKMN-RJUBDTSPSA-N
SMILESCC(C)(C)OC(=O)N1CC[C@H](C[C@H]1C(=O)OC)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)