CAS 2922439-48-1 is the registry number for 1-(tert-Butyl) 3-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate oxalate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1-O-tert-butyl 3-O-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate;oxalic acid (CAS 2922439-48-1) is a chemical compound with the molecular formula C14H24N2O8 and a molecular weight of 348.35 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate;oxalic acid. InChIKey: LLRLFDPWCXPSAB-OULXEKPRSA-N.
| Molecular formula | C14H24N2O8 |
|---|---|
| Molecular weight | 348.35 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-aminopyrrolidine-1,3-dicarboxylate;oxalic acid |
| InChIKey | LLRLFDPWCXPSAB-OULXEKPRSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@H]1N)C(=O)OC(C)(C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)