Products 2922439-55-0

CAS 2922439-55-0 is the registry number for O1-tert-butyl O3-ethyl (3R,4R)-4-aminopyrrolidine-1,3-dicarboxylate,oxalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-ethyl (3R,4R)-4-aminopyrrolidine-1,3-dicarboxylate;oxalic acid (CAS 2922439-55-0) is a chemical compound with the molecular formula C14H24N2O8 and a molecular weight of 348.35 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,4R)-4-aminopyrrolidine-1,3-dicarboxylate;oxalic acid. InChIKey: LLRLFDPWCXPSAB-RJUBDTSPSA-N.

Identity
Molecular formulaC14H24N2O8
Molecular weight348.35 g/mol
IUPAC name1-O-tert-butyl 3-O-ethyl (3R,4R)-4-aminopyrrolidine-1,3-dicarboxylate;oxalic acid
InChIKeyLLRLFDPWCXPSAB-RJUBDTSPSA-N
SMILESCCOC(=O)[C@@H]1CN(C[C@@H]1N)C(=O)OC(C)(C)C.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)