Products 126320-79-4
CAS 126320-79-4 is the registry number for Suprofen-d3. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
3,3,3-trideuterio-2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid (CAS 126320-79-4) is a chemical compound with the molecular formula C14H12O3S and a molecular weight of 263.33 g/mol. IUPAC name: 3,3,3-trideuterio-2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid. InChIKey: MDKGKXOCJGEUJW-FIBGUPNXSA-N.
| Molecular formula | C14H12O3S |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid |
| InChIKey | MDKGKXOCJGEUJW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)C(=O)C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)