Products 19715-49-2

CAS 19715-49-2 appears in our catalog under these names: 4-(Dimethylamino)benzene-1-sulfonyl chloride, 95%, 4-(Dimethylamino)benzene-1-sulfonyl chloride, 4-(Dimethylamino)benzene-1-sulfonyl chloride 95%, 4-(Dimethylamino)benzenesulfonyl chloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg, 5g.

Structural formula: {0} (CAS {1})

4-(dimethylamino)benzenesulfonyl chloride (CAS 19715-49-2) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 4-(dimethylamino)benzenesulfonyl chloride. InChIKey: RTQAIFXZCMVBDT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO2S
Molecular weight219.69 g/mol
IUPAC name4-(dimethylamino)benzenesulfonyl chloride
InChIKeyRTQAIFXZCMVBDT-UHFFFAOYSA-N
SMILESCN(C)C1=CC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)