CAS 219689-73-3 appears in our catalog under these names: 4-Chloro-2,5-dimethylbenzenesulfonamide, 95%, 4-Chloro-2,5-dimethylbenzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,25g, 2,5g.
4-chloro-2,5-dimethylbenzenesulfonamide (CAS 219689-73-3) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 4-chloro-2,5-dimethylbenzenesulfonamide. InChIKey: YSDCIOQWHXYICL-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 4-chloro-2,5-dimethylbenzenesulfonamide |
| InChIKey | YSDCIOQWHXYICL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C)S(=O)(=O)N |
Computed by PubChem (NCBI)