CAS 36959-70-3 appears in our catalog under these names: Benzyl(methyl)sulfamoyl chloride, 95%, Benzylmethylsulfamoyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g.
N-benzyl-N-methylsulfamoyl chloride (CAS 36959-70-3) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: N-benzyl-N-methylsulfamoyl chloride. InChIKey: VURHMMRCYKRHOT-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | N-benzyl-N-methylsulfamoyl chloride |
| InChIKey | VURHMMRCYKRHOT-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)