CAS 1263357-67-0 is the registry number for Fasudil Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
Isoquinoline-6-sulfonic acid (CAS 1263357-67-0) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: isoquinoline-6-sulfonic acid. InChIKey: UUTFFQSNOBCVHW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | isoquinoline-6-sulfonic acid |
| InChIKey | UUTFFQSNOBCVHW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C=C1S(=O)(=O)O |
Computed by PubChem (NCBI)