Products 1263378-54-6

CAS 1263378-54-6 is the registry number for tert-Butyl azepan-4-ylcarbamate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(azepan-4-yl)carbamate;hydrochloride (CAS 1263378-54-6) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl N-(azepan-4-yl)carbamate;hydrochloride. InChIKey: ZRFSAZHRFOYRMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H23ClN2O2
Molecular weight250.76 g/mol
IUPAC nametert-butyl N-(azepan-4-yl)carbamate;hydrochloride
InChIKeyZRFSAZHRFOYRMQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCCNCC1.Cl

Computed by PubChem (NCBI)