Products 1263378-69-3
CAS 1263378-69-3 is the registry number for (2-Methyl-3-(trifluoromethyl)phenyl)hydrazine hydrochloride, 95+%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
[2-methyl-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 1263378-69-3) is a chemical compound with the molecular formula C8H10ClF3N2 and a molecular weight of 226.62 g/mol. IUPAC name: [2-methyl-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: COEZSYPSBKUPOU-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF3N2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | [2-methyl-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | COEZSYPSBKUPOU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)