CAS 1265908-21-1 is the registry number for (4S)-2-(4-Hydroxy-3,5-dimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4S)-2-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 1265908-21-1) is a chemical compound with the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. IUPAC name: (4S)-2-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: RZIREYLLBTUPAS-DKSCNQEISA-N.
| Molecular formula | C12H15NO5S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | (4S)-2-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | RZIREYLLBTUPAS-DKSCNQEISA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)C2N[C@H](CS2)C(=O)O |
Computed by PubChem (NCBI)