Products 21797-50-2
CAS 21797-50-2 is the registry number for (2R,3S,4S,5S,6R)-2-(Hydroxymethyl)-6-phenoxytetrahydro-2H-pyran-3,4,5-triol, 98%. Offered by: Ambeed. Available pack sizes: 50mg.
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol (CAS 21797-50-2) is a chemical compound with the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. IUPAC name: (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol. InChIKey: NEZJDVYDSZTRFS-GCHJQGSQSA-N.
| Molecular formula | C12H16O6 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol |
| InChIKey | NEZJDVYDSZTRFS-GCHJQGSQSA-N |
| SMILES | C1=CC=C(C=C1)O[C@@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)