CAS 126674-98-4 appears in our catalog under these names: 1-Methyl-3-(trifluoromethyl)-1h-pyrazole-4-carbonyl chloride, 98%, 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carbonyl chloride, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 5g, 1g, 250MG.
1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride (CAS 126674-98-4) is a chemical compound with the molecular formula C6H4ClF3N2O and a molecular weight of 212.56 g/mol. IUPAC name: 1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride. InChIKey: KFKVECZQALNWSR-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O |
|---|---|
| Molecular weight | 212.56 g/mol |
| IUPAC name | 1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
| InChIKey | KFKVECZQALNWSR-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)