CAS 129768-24-7 appears in our catalog under these names: 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-carbonyl chloride 95%, 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-carbonyl chloride, 95%, 95%, 1-Methyl-3-trifluoromethyl-1H-pyrazole-5-carbonyl chloride. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg, 500mg.
1-methyl-3-(trifluoromethyl)pyrazole-5-carbonyl chloride (CAS 129768-24-7) is a chemical compound with the molecular formula C6H4ClF3N2O and a molecular weight of 212.56 g/mol. IUPAC name: 1-methyl-3-(trifluoromethyl)pyrazole-5-carbonyl chloride. InChIKey: PLGFQFMBCLCVRB-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O |
|---|---|
| Molecular weight | 212.56 g/mol |
| IUPAC name | 1-methyl-3-(trifluoromethyl)pyrazole-5-carbonyl chloride |
| InChIKey | PLGFQFMBCLCVRB-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)