CAS 1312535-76-4 appears in our catalog under these names: 2-Chloro-4-methoxy-5-(trifluoromethyl)pyrimidine, 95%, 2-Chloro-4-methoxy-5-(trifluoromethyl)pyrimidine 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 50mg, 5g.
2-chloro-4-methoxy-5-(trifluoromethyl)pyrimidine (CAS 1312535-76-4) is a chemical compound with the molecular formula C6H4ClF3N2O and a molecular weight of 212.56 g/mol. IUPAC name: 2-chloro-4-methoxy-5-(trifluoromethyl)pyrimidine. InChIKey: XXUSEPOFBSZNLR-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O |
|---|---|
| Molecular weight | 212.56 g/mol |
| IUPAC name | 2-chloro-4-methoxy-5-(trifluoromethyl)pyrimidine |
| InChIKey | XXUSEPOFBSZNLR-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)