CAS 128455-62-9 appears in our catalog under these names: 5-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carbaldehyde 98%, 5-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carbaldehyde, 98%, 98%, 5-Chloro-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxaldehyde, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 250mg, 1g, 5g, 25g, 10g.
5-chloro-1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde (CAS 128455-62-9) is a chemical compound with the molecular formula C6H4ClF3N2O and a molecular weight of 212.56 g/mol. IUPAC name: 5-chloro-1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde. InChIKey: PZOZNOVIRZSNHJ-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O |
|---|---|
| Molecular weight | 212.56 g/mol |
| IUPAC name | 5-chloro-1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
| InChIKey | PZOZNOVIRZSNHJ-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(F)(F)F)C=O)Cl |
Computed by PubChem (NCBI)