CAS 1402551-64-7 appears in our catalog under these names: 2-Chloro-4-methoxy-6-(trifluoromethyl)pyrimidine, 98%, 2-Chloro-4-methoxy-6-(trifluoromethyl)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-4-methoxy-6-(trifluoromethyl)pyrimidine (CAS 1402551-64-7) is a chemical compound with the molecular formula C6H4ClF3N2O and a molecular weight of 212.56 g/mol. IUPAC name: 2-chloro-4-methoxy-6-(trifluoromethyl)pyrimidine. InChIKey: CBJNQGZYEYYRMP-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2O |
|---|---|
| Molecular weight | 212.56 g/mol |
| IUPAC name | 2-chloro-4-methoxy-6-(trifluoromethyl)pyrimidine |
| InChIKey | CBJNQGZYEYYRMP-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)