CAS 126727-04-6 appears in our catalog under these names: Fmoc–DL–Phe–OH, 2-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)-3-phenylpropanoic acid, Fmoc-DL-Phe-OH 97%, Fmoc-DL-Phe-OH, 97%, 97%, Fmoc-DL-Phe-OH, 99.78%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 10 g, 5 g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid (CAS 126727-04-6) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid. InChIKey: SJVFAHZPLIXNDH-UHFFFAOYSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid |
| InChIKey | SJVFAHZPLIXNDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)