Products 1267337-47-2
CAS 1267337-47-2 appears in our catalog under these names: 3–(4–Bromophenyl)piperidine–2，6–dione, 3-(4-Bromophenyl)piperidine-2,6-dione, 3-(4-Bromophenyl)piperidine-2,6-dione 98%, 3-(4-Bromophenyl)piperidine-2,6-dione, 98%, 98%, CRBN ligand-880, 99.96%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 5g, 50g, 25g, 500mg, 10g.
3-(4-bromophenyl)piperidine-2,6-dione (CAS 1267337-47-2) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 3-(4-bromophenyl)piperidine-2,6-dione. InChIKey: YPICLEOQEVPRGE-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 3-(4-bromophenyl)piperidine-2,6-dione |
| InChIKey | YPICLEOQEVPRGE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)