CAS 38444-77-8 appears in our catalog under these names: 2',4,6'-Trichlorobipheny, PCB 32, ROTI®Star, 10 mg, glass. Offered by: TRC, Roth. Available pack sizes: 1g, 10mg.
1,3-dichloro-2-(4-chlorophenyl)benzene (CAS 38444-77-8) is a chemical compound with the molecular formula C12H7Cl3 and a molecular weight of 257.5 g/mol. IUPAC name: 1,3-dichloro-2-(4-chlorophenyl)benzene. InChIKey: IHIDFKLAWYPTKB-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3 |
|---|---|
| Molecular weight | 257.5 g/mol |
| IUPAC name | 1,3-dichloro-2-(4-chlorophenyl)benzene |
| InChIKey | IHIDFKLAWYPTKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)