Products 1267548-63-9
CAS 1267548-63-9 is the registry number for 1-(2,5-Dimethoxyphenyl)-1H-1,2,3-triazole-4-carboxylic acid, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
1-(2,5-dimethoxyphenyl)triazole-4-carboxylic acid (CAS 1267548-63-9) is a chemical compound with the molecular formula C11H11N3O4 and a molecular weight of 249.22 g/mol. IUPAC name: 1-(2,5-dimethoxyphenyl)triazole-4-carboxylic acid. InChIKey: FVKKAAQOQARNFM-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O4 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 1-(2,5-dimethoxyphenyl)triazole-4-carboxylic acid |
| InChIKey | FVKKAAQOQARNFM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)