Products 33042-97-6

CAS 33042-97-6 is the registry number for Z-Dl-leu-nh2, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-(1-amino-4-methyl-1-oxopentan-2-yl)carbamate (CAS 33042-97-6) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: benzyl N-(1-amino-4-methyl-1-oxopentan-2-yl)carbamate. InChIKey: JZEYMGMOBIYUOV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20N2O3
Molecular weight264.32 g/mol
IUPAC namebenzyl N-(1-amino-4-methyl-1-oxopentan-2-yl)carbamate
InChIKeyJZEYMGMOBIYUOV-UHFFFAOYSA-N
SMILESCC(C)CC(C(=O)N)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)