CAS 1267956-72-8 appears in our catalog under these names: 3-Methyl-1-(3-nitrophenyl)butan-1-one, 95%, 3-Methyl-1-(3-nitrophenyl)butan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, 1000mg.
3-methyl-1-(3-nitrophenyl)butan-1-one (CAS 1267956-72-8) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 3-methyl-1-(3-nitrophenyl)butan-1-one. InChIKey: UCYAAGQRJQBBSU-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 3-methyl-1-(3-nitrophenyl)butan-1-one |
| InChIKey | UCYAAGQRJQBBSU-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)