Products 1268467-11-3
CAS 1268467-11-3 is the registry number for 5-Methyl-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 1g, 2g, 5g.
5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-oxadiazole (CAS 1268467-11-3) is a chemical compound with the molecular formula C9H15BN2O3 and a molecular weight of 210.04 g/mol. IUPAC name: 5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-oxadiazole. InChIKey: NURDLNKQOPQJTQ-UHFFFAOYSA-N.
| Molecular formula | C9H15BN2O3 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | 5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-oxadiazole |
| InChIKey | NURDLNKQOPQJTQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NOC(=N2)C |
Computed by PubChem (NCBI)