CAS 1445860-52-5 is the registry number for 2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4-oxadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4-oxadiazole (CAS 1445860-52-5) is a chemical compound with the molecular formula C9H15BN2O3 and a molecular weight of 210.04 g/mol. IUPAC name: 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4-oxadiazole. InChIKey: PJGAIJZWSZAVNR-UHFFFAOYSA-N.
| Molecular formula | C9H15BN2O3 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4-oxadiazole |
| InChIKey | PJGAIJZWSZAVNR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN=C(O2)C |
Computed by PubChem (NCBI)