Products 2246772-81-4

CAS 2246772-81-4 is the registry number for (1-((Tetrahydro-2H-pyran-4-yl)methyl)-1H-pyrazol-4-yl)boronic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

[1-(oxan-4-ylmethyl)pyrazol-4-yl]boronic acid (CAS 2246772-81-4) is a chemical compound with the molecular formula C9H15BN2O3 and a molecular weight of 210.04 g/mol. IUPAC name: [1-(oxan-4-ylmethyl)pyrazol-4-yl]boronic acid. InChIKey: YQNZFBOINLCQTF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15BN2O3
Molecular weight210.04 g/mol
IUPAC name[1-(oxan-4-ylmethyl)pyrazol-4-yl]boronic acid
InChIKeyYQNZFBOINLCQTF-UHFFFAOYSA-N
SMILESB(C1=CN(N=C1)CC2CCOCC2)(O)O

Computed by PubChem (NCBI)