Products 2241864-87-7
CAS 2241864-87-7 is the registry number for (4–(4–methylpiperazin–1–yl)furan–2–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[4-(4-methylpiperazin-1-yl)furan-2-yl]boronic acid (CAS 2241864-87-7) is a chemical compound with the molecular formula C9H15BN2O3 and a molecular weight of 210.04 g/mol. IUPAC name: [4-(4-methylpiperazin-1-yl)furan-2-yl]boronic acid. InChIKey: HMMTUSQSMDMMAG-UHFFFAOYSA-N.
| Molecular formula | C9H15BN2O3 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | [4-(4-methylpiperazin-1-yl)furan-2-yl]boronic acid |
| InChIKey | HMMTUSQSMDMMAG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CO1)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)