Products 2225170-17-0
CAS 2225170-17-0 appears in our catalog under these names: B-(5-(4-Methyl-1-piperazinyl)-2-furanyl)-Boronic Acid, 5–(N–Methylpiperazin–1–yl)furan–2–boronic acid. Offered by: TRC, GLPBio. Available pack sizes: 500mg, 25mg, 5mg.
[5-(4-methylpiperazin-1-yl)furan-2-yl]boronic acid (CAS 2225170-17-0) is a chemical compound with the molecular formula C9H15BN2O3 and a molecular weight of 210.04 g/mol. IUPAC name: [5-(4-methylpiperazin-1-yl)furan-2-yl]boronic acid. InChIKey: HKILBHWETJNIFX-UHFFFAOYSA-N.
| Molecular formula | C9H15BN2O3 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | [5-(4-methylpiperazin-1-yl)furan-2-yl]boronic acid |
| InChIKey | HKILBHWETJNIFX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(O1)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)