CAS 1268521-24-9 appears in our catalog under these names: 2,5,8-Trichloropyrido(2,3-d)pyridazine, 97%, 2,5,8-Trichloropyrido(2,3-d)pyridazine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
2,5,8-trichloropyrido[2,3-d]pyridazine (CAS 1268521-24-9) is a chemical compound with the molecular formula C7H2Cl3N3 and a molecular weight of 234.5 g/mol. IUPAC name: 2,5,8-trichloropyrido[2,3-d]pyridazine. InChIKey: RNGUDERGBSCKHI-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3N3 |
|---|---|
| Molecular weight | 234.5 g/mol |
| IUPAC name | 2,5,8-trichloropyrido[2,3-d]pyridazine |
| InChIKey | RNGUDERGBSCKHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=NN=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)