CAS 2820180-67-2 is the registry number for 4,6,7-Trichloropyrido[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6,7-trichloropyrido[2,3-d]pyrimidine (CAS 2820180-67-2) is a chemical compound with the molecular formula C7H2Cl3N3 and a molecular weight of 234.5 g/mol. IUPAC name: 4,6,7-trichloropyrido[2,3-d]pyrimidine. InChIKey: ZNRDEMCIAKGRAF-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3N3 |
|---|---|
| Molecular weight | 234.5 g/mol |
| IUPAC name | 4,6,7-trichloropyrido[2,3-d]pyrimidine |
| InChIKey | ZNRDEMCIAKGRAF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Cl)Cl)N=CN=C2Cl |
Computed by PubChem (NCBI)