CAS 39225-62-2 is the registry number for 3,5,8-Trichloropyrido[2,3-d]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5,8-trichloropyrido[2,3-d]pyridazine (CAS 39225-62-2) is a chemical compound with the molecular formula C7H2Cl3N3 and a molecular weight of 234.5 g/mol. IUPAC name: 3,5,8-trichloropyrido[2,3-d]pyridazine. InChIKey: KQMWFAXMXRPUJL-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3N3 |
|---|---|
| Molecular weight | 234.5 g/mol |
| IUPAC name | 3,5,8-trichloropyrido[2,3-d]pyridazine |
| InChIKey | KQMWFAXMXRPUJL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=NN=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)