CAS 1429377-73-0 is the registry number for 2,3,6-Trichloropyrido[2,3-b]pyrazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,6-trichloropyrido[2,3-b]pyrazine (CAS 1429377-73-0) is a chemical compound with the molecular formula C7H2Cl3N3 and a molecular weight of 234.5 g/mol. IUPAC name: 2,3,6-trichloropyrido[2,3-b]pyrazine. InChIKey: BRVIUKXANNPRCG-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3N3 |
|---|---|
| Molecular weight | 234.5 g/mol |
| IUPAC name | 2,3,6-trichloropyrido[2,3-b]pyrazine |
| InChIKey | BRVIUKXANNPRCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(C(=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)