CAS 1470249-17-2 appears in our catalog under these names: 2,4,8-Trichloropyrido[3,4-d]pyrimidine, 95%, 2,4,8-Trichloropyrido[3,4-d]pyrimidine 95%, 2,4,8-Trichloropyrido[3,4-d]pyrimidine, 97%, 97%, 2,4,8-TRICHLOROPYRIDO[3,4-D]PYRIMIDINE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 500mg.
2,4,8-trichloropyrido[3,4-d]pyrimidine (CAS 1470249-17-2) is a chemical compound with the molecular formula C7H2Cl3N3 and a molecular weight of 234.5 g/mol. IUPAC name: 2,4,8-trichloropyrido[3,4-d]pyrimidine. InChIKey: CKGWRKCQLNZTDI-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3N3 |
|---|---|
| Molecular weight | 234.5 g/mol |
| IUPAC name | 2,4,8-trichloropyrido[3,4-d]pyrimidine |
| InChIKey | CKGWRKCQLNZTDI-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=NC(=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)