CAS 1268718-23-5 is the registry number for 2-fluoro-3-methoxy-6-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-fluoro-3-methoxy-6-methylbenzoic acid (CAS 1268718-23-5) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-fluoro-3-methoxy-6-methylbenzoic acid. InChIKey: WBDRHEGJCLGYDN-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 2-fluoro-3-methoxy-6-methylbenzoic acid |
| InChIKey | WBDRHEGJCLGYDN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)OC)F)C(=O)O |
Computed by PubChem (NCBI)