CAS 1269052-70-1 appears in our catalog under these names: [3-(1H-Imidazol-5-yl)phenyl]amine hydrochloride, 95%, 3-(1H-Imidazol-5-yl)aniline hydrochloride 95%, 3-(1H-Imidazol-5-yl)aniline hydrochloride, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g.
3-(1H-imidazol-5-yl)aniline;hydrochloride (CAS 1269052-70-1) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 3-(1H-imidazol-5-yl)aniline;hydrochloride. InChIKey: IFYXKWHSCFOXJN-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 3-(1H-imidazol-5-yl)aniline;hydrochloride |
| InChIKey | IFYXKWHSCFOXJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CN=CN2.Cl |
Computed by PubChem (NCBI)