Products 1269247-74-6
CAS 1269247-74-6 is the registry number for 4,4,5-Trimethyl-5-(prop-2-yn-1-yloxy)-1,3-dioxolan-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,5-trimethyl-5-prop-2-ynoxy-1,3-dioxolan-2-one (CAS 1269247-74-6) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 4,4,5-trimethyl-5-prop-2-ynoxy-1,3-dioxolan-2-one. InChIKey: VDRORKVHFBJRCY-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 4,4,5-trimethyl-5-prop-2-ynoxy-1,3-dioxolan-2-one |
| InChIKey | VDRORKVHFBJRCY-UHFFFAOYSA-N |
| SMILES | CC1(C(OC(=O)O1)(C)OCC#C)C |
Computed by PubChem (NCBI)