Products 126926-36-1
CAS 126926-36-1 appears in our catalog under these names: 3-Formyl-n,n-dimethylbenzamide, 96%, 3-Formyl-N,N-dimethylbenzamide, 3-Formyl-N,N-dimethylbenzamide 98%, 3-Formyl-N,N-dimethylbenzamide, 98%, 98%, 3-Formyl-N,N-dimethylbenzamide, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 2,5g, 100mg.
3-formyl-N,N-dimethylbenzamide (CAS 126926-36-1) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 3-formyl-N,N-dimethylbenzamide. InChIKey: MYTDKUFZGNDHRL-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 3-formyl-N,N-dimethylbenzamide |
| InChIKey | MYTDKUFZGNDHRL-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC(=C1)C=O |
Computed by PubChem (NCBI)