Products 1269291-66-8

CAS 1269291-66-8 appears in our catalog under these names: 3-Amino-2-bromopyridine-4-carboxylic acid, 95%, 3-Amino-2-bromoisonicotinic acid, 97%, 3-Amino-2-bromopyridine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-amino-2-bromopyridine-4-carboxylic acid (CAS 1269291-66-8) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 3-amino-2-bromopyridine-4-carboxylic acid. InChIKey: DSPNPNXNZQMNHI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrN2O2
Molecular weight217.02 g/mol
IUPAC name3-amino-2-bromopyridine-4-carboxylic acid
InChIKeyDSPNPNXNZQMNHI-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1C(=O)O)N)Br

Computed by PubChem (NCBI)