CAS 1269292-02-5 appears in our catalog under these names: 3-bromo-2-methyl-5-nitrobenzoic acid, 3-Bromo-2-methyl-5-nitrobenzoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-bromo-2-methyl-5-nitrobenzoic acid (CAS 1269292-02-5) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: 3-bromo-2-methyl-5-nitrobenzoic acid. InChIKey: QQHDTQSCWLYJHU-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 3-bromo-2-methyl-5-nitrobenzoic acid |
| InChIKey | QQHDTQSCWLYJHU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)