Products 1269667-57-3
CAS 1269667-57-3 appears in our catalog under these names: 4-Chlorothieno[3,2-d]pyrimidine-7-carboxylic acid, 95%, 4-Chlorothieno(3,2-d)pyrimidine-7-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 10g.
4-chlorothieno[3,2-d]pyrimidine-7-carboxylic acid (CAS 1269667-57-3) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 4-chlorothieno[3,2-d]pyrimidine-7-carboxylic acid. InChIKey: DTARXUPVWGNDNT-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | 4-chlorothieno[3,2-d]pyrimidine-7-carboxylic acid |
| InChIKey | DTARXUPVWGNDNT-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)