CAS 110651-92-8 appears in our catalog under these names: 7-Chloro-6-nitrothieno[3,2-b]pyridine, 95%, 7–Chloro–6–nitrothieno(3,2–b)pyridine, Thieno[3,2-b]pyridine, 7-chloro-6-nitro-, 96%, 96%, 7-Chloro-6-nitrothieno[3,2-b]pyridine, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
7-chloro-6-nitrothieno[3,2-b]pyridine (CAS 110651-92-8) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 7-chloro-6-nitrothieno[3,2-b]pyridine. InChIKey: RKZKGVJIROTNKJ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | 7-chloro-6-nitrothieno[3,2-b]pyridine |
| InChIKey | RKZKGVJIROTNKJ-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C(C(=CN=C21)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)