Products 1087792-31-1

CAS 1087792-31-1 is the registry number for 5-Chloro-4-nitro-1,3-benzothiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

5-chloro-4-nitro-1,3-benzothiazole (CAS 1087792-31-1) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 5-chloro-4-nitro-1,3-benzothiazole. InChIKey: JCWDUKKVPUULOU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClN2O2S
Molecular weight214.63 g/mol
IUPAC name5-chloro-4-nitro-1,3-benzothiazole
InChIKeyJCWDUKKVPUULOU-UHFFFAOYSA-N
SMILESC1=CC(=C(C2=C1SC=N2)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)