CAS 1087792-31-1 is the registry number for 5-Chloro-4-nitro-1,3-benzothiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-chloro-4-nitro-1,3-benzothiazole (CAS 1087792-31-1) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 5-chloro-4-nitro-1,3-benzothiazole. InChIKey: JCWDUKKVPUULOU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | 5-chloro-4-nitro-1,3-benzothiazole |
| InChIKey | JCWDUKKVPUULOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1SC=N2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)