CAS 127142-66-9 appears in our catalog under these names: 4-Chloro-3-nitrophenyl isothiocyanate, 97% , 4-Chloro-3-nitrophenyl isothiocyanate, 98%. Offered by: Thermo Scientific, Fluorochem. Available pack sizes: 5g, 10g, 25g.
1-chloro-4-isothiocyanato-2-nitrobenzene (CAS 127142-66-9) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: 1-chloro-4-isothiocyanato-2-nitrobenzene. InChIKey: ZXGZBHIDSJXKLE-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | 1-chloro-4-isothiocyanato-2-nitrobenzene |
| InChIKey | ZXGZBHIDSJXKLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=S)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)