CAS 89642-54-6 appears in our catalog under these names: 4-Chloro-3-nitrophenyl thiocyanate, 95%, 1-Chloro-2-nitro-4-thiocyanatobenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(4-chloro-3-nitrophenyl) thiocyanate (CAS 89642-54-6) is a chemical compound with the molecular formula C7H3ClN2O2S and a molecular weight of 214.63 g/mol. IUPAC name: (4-chloro-3-nitrophenyl) thiocyanate. InChIKey: GRHGJYAFPDLXHM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2S |
|---|---|
| Molecular weight | 214.63 g/mol |
| IUPAC name | (4-chloro-3-nitrophenyl) thiocyanate |
| InChIKey | GRHGJYAFPDLXHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SC#N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)