CAS 1269822-94-7 is the registry number for Methyl 4-acetyl-5-nitro-1H-pyrrole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 4-acetyl-5-nitro-1H-pyrrole-2-carboxylate (CAS 1269822-94-7) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: methyl 4-acetyl-5-nitro-1H-pyrrole-2-carboxylate. InChIKey: YZSBUCXXYJGFNU-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | methyl 4-acetyl-5-nitro-1H-pyrrole-2-carboxylate |
| InChIKey | YZSBUCXXYJGFNU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(NC(=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)