Products 1269822-94-7

CAS 1269822-94-7 is the registry number for Methyl 4-acetyl-5-nitro-1H-pyrrole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 4-acetyl-5-nitro-1H-pyrrole-2-carboxylate (CAS 1269822-94-7) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: methyl 4-acetyl-5-nitro-1H-pyrrole-2-carboxylate. InChIKey: YZSBUCXXYJGFNU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O5
Molecular weight212.16 g/mol
IUPAC namemethyl 4-acetyl-5-nitro-1H-pyrrole-2-carboxylate
InChIKeyYZSBUCXXYJGFNU-UHFFFAOYSA-N
SMILESCC(=O)C1=C(NC(=C1)C(=O)OC)[N+](=O)[O-]

Computed by PubChem (NCBI)