CAS 1269923-87-6 is the registry number for (R)-2-Methoxy-1-(3,4,5-trifluorophenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2-methoxy-1-(3,4,5-trifluorophenyl)ethanamine (CAS 1269923-87-6) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: (1R)-2-methoxy-1-(3,4,5-trifluorophenyl)ethanamine. InChIKey: XWXXMFALIKKIKK-QMMMGPOBSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | (1R)-2-methoxy-1-(3,4,5-trifluorophenyl)ethanamine |
| InChIKey | XWXXMFALIKKIKK-QMMMGPOBSA-N |
| SMILES | COC[C@@H](C1=CC(=C(C(=C1)F)F)F)N |
Computed by PubChem (NCBI)