CAS 1270344-10-9 appears in our catalog under these names: 2-Methoxy-1-(3,4,5-trifluorophenyl)ethan-1-amine, 95%, 2-Methoxy-1-(3,4,5-trifluorophenyl)ethan-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2-methoxy-1-(3,4,5-trifluorophenyl)ethanamine (CAS 1270344-10-9) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: 2-methoxy-1-(3,4,5-trifluorophenyl)ethanamine. InChIKey: XWXXMFALIKKIKK-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 2-methoxy-1-(3,4,5-trifluorophenyl)ethanamine |
| InChIKey | XWXXMFALIKKIKK-UHFFFAOYSA-N |
| SMILES | COCC(C1=CC(=C(C(=C1)F)F)F)N |
Computed by PubChem (NCBI)