CAS 1269945-28-9 is the registry number for (S)–2–Amino–3–(6–(trifluoromethyl)pyridin–3–yl)propanoic acid. Offered by: GLPBio. Available pack sizes: 1g.
(2S)-2-amino-3-[6-(trifluoromethyl)-3-pyridinyl]propanoic acid (CAS 1269945-28-9) is a chemical compound with the molecular formula C9H9F3N2O2 and a molecular weight of 234.17 g/mol. IUPAC name: (2S)-2-amino-3-[6-(trifluoromethyl)-3-pyridinyl]propanoic acid. InChIKey: WWXLHNPRZPZWHD-LURJTMIESA-N.
| Molecular formula | C9H9F3N2O2 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | (2S)-2-amino-3-[6-(trifluoromethyl)-3-pyridinyl]propanoic acid |
| InChIKey | WWXLHNPRZPZWHD-LURJTMIESA-N |
| SMILES | C1=CC(=NC=C1C[C@@H](C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)