Products 1270290-33-9
CAS 1270290-33-9 appears in our catalog under these names: (1S)-7-Chloro-1,2,3,4-tetrahydronaphthalen-1-ol, 95%, (1S)-7-Chloro-1,2,3,4-tetrahydronaphthalen-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1S)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 1270290-33-9) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: (1S)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: IPHXZGPPFVUBEW-JTQLQIEISA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | (1S)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | IPHXZGPPFVUBEW-JTQLQIEISA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)